C12H15N3O2S — CID 113447943
ethyl 4-amino-2-pent-3-ynylsulfanylpyrimidine-5-carboxylate (PubChem CID 113447943) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is ethyl 4-amino-2-pent-3-ynylsulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-pent-3-ynylsulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 113447943 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 4-amino-2-pent-3-ynylsulfanylpyrimidine-5-carboxylate |
| SMILES | CC#CCCSc1ncc(C(=O)OCC)c(N)n1 |
| InChI | InChI=1S/C12H15N3O2S/c1-3-5-6-7-18-12-14-8-9(10(13)15-12)11(16)17-4-2/h8H,4,6-7H2,1-2H3,(H2,13,14,15) |
| InChIKey | FHAFAQVYXOIFNF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|