C10H13N7O2S — CID 107043531
ethyl 4-amino-2-[(2-methyltetrazol-5-yl)methylsulfanyl]pyrimidine-5-carboxylate (PubChem CID 107043531) has the molecular formula C10H13N7O2S and a molecular weight of 295.33 g/mol. Its IUPAC name is ethyl 4-amino-2-[(2-methyltetrazol-5-yl)methylsulfanyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[(2-methyltetrazol-5-yl)methylsulfanyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 107043531 |
| Molecular Formula | C10H13N7O2S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | ethyl 4-amino-2-[(2-methyltetrazol-5-yl)methylsulfanyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCc2nnn(C)n2)nc1N |
| InChI | InChI=1S/C10H13N7O2S/c1-3-19-9(18)6-4-12-10(13-8(6)11)20-5-7-14-16-17(2)15-7/h4H,3,5H2,1-2H3,(H2,11,12,13) |
| InChIKey | VUUXWIPMHNNHFY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |