C15H14BrN3O3S — CID 603916
ethyl 4-amino-2-[2-(4-bromophenyl)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 603916) has the molecular formula C15H14BrN3O3S and a molecular weight of 396.27 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(4-bromophenyl)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(4-bromophenyl)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 603916 |
| Molecular Formula | C15H14BrN3O3S |
| Molecular Weight | 396.27 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | ethyl 4-amino-2-[2-(4-bromophenyl)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)c2ccc(Br)cc2)nc1N |
| InChI | InChI=1S/C15H14BrN3O3S/c1-2-22-14(21)11-7-18-15(19-13(11)17)23-8-12(20)9-3-5-10(16)6-4-9/h3-7H,2,8H2,1H3,(H2,17,18,19) |
| InChIKey | QQKHOEDWSRZGOV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |