C16H17BrN4O3S — CID 17336731
ethyl 4-amino-2-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 17336731) has the molecular formula C16H17BrN4O3S and a molecular weight of 425.31 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 17336731 |
| Molecular Formula | C16H17BrN4O3S |
| Molecular Weight | 425.31 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | ethyl 4-amino-2-[2-(4-bromo-2-methylanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)Nc2ccc(Br)cc2C)nc1N |
| InChI | InChI=1S/C16H17BrN4O3S/c1-3-24-15(23)11-7-19-16(21-14(11)18)25-8-13(22)20-12-5-4-10(17)6-9(12)2/h4-7H,3,8H2,1-2H3,(H,20,22)(H2,18,19,21) |
| InChIKey | SSQXJCUESYNCKG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |