C15H14ClN5O5S — CID 31830535
ethyl 4-amino-2-[2-(4-chloro-3-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate (PubChem CID 31830535) has the molecular formula C15H14ClN5O5S and a molecular weight of 411.83 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-(4-chloro-3-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[2-(4-chloro-3-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 31830535 |
| Molecular Formula | C15H14ClN5O5S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | ethyl 4-amino-2-[2-(4-chloro-3-nitroanilino)-2-oxoethyl]sulfanylpyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SCC(=O)Nc2ccc(Cl)c([N+](=O)[O-])c2)nc1N |
| InChI | InChI=1S/C15H14ClN5O5S/c1-2-26-14(23)9-6-18-15(20-13(9)17)27-7-12(22)19-8-3-4-10(16)11(5-8)21(24)25/h3-6H,2,7H2,1H3,(H,19,22)(H2,17,18,20) |
| InChIKey | SNCKWOHCQFEGCN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|