C12H11F3N2O5 — CID 7851443
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] propanoate (PubChem CID 7851443) has the molecular formula C12H11F3N2O5 and a molecular weight of 320.22 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] propanoate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] propanoate |
|---|---|
| PubChem CID | 7851443 |
| Molecular Formula | C12H11F3N2O5 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] propanoate |
| SMILES | CCC(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O5/c1-2-11(19)22-6-10(18)16-9-4-3-7(17(20)21)5-8(9)12(13,14)15/h3-5H,2,6H2,1H3,(H,16,18) |
| InChIKey | HUSWPWHQRIZTQS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|