C20H20F3N3O7 — CID 26058054
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 26058054) has the molecular formula C20H20F3N3O7 and a molecular weight of 471.39 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 26058054 |
| Molecular Formula | C20H20F3N3O7 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (2S)-2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | C[C@@H](C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F)N1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C20H20F3N3O7/c1-10(25-17(28)12-4-2-3-5-13(12)18(25)29)19(30)33-9-16(27)24-15-7-6-11(26(31)32)8-14(15)20(21,22)23/h6-8,10,12-13H,2-5,9H2,1H3,(H,24,27)/t10-,12-,13+/m0/s1 |
| InChIKey | YNPZIWDFOTYFEA-WCFLWFBJSA-N |
| XLogP | 2.66 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|