C13H13F3N2O5 — CID 7796971
[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] butanoate (PubChem CID 7796971) has the molecular formula C13H13F3N2O5 and a molecular weight of 334.25 g/mol. Its IUPAC name is [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] butanoate.
| Compound Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] butanoate |
|---|---|
| PubChem CID | 7796971 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] butanoate |
| SMILES | CCCC(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O5/c1-2-3-12(20)23-7-11(19)17-10-5-4-8(18(21)22)6-9(10)13(14,15)16/h4-6H,2-3,7H2,1H3,(H,17,19) |
| InChIKey | LMNYFEFAUIDRHX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|