C14H13F3N2O5 — CID 8004847
trans-[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate (PubChem CID 8004847) has the molecular formula C14H13F3N2O5 and a molecular weight of 346.26 g/mol. Its IUPAC name is trans-[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate.
| Compound Name | trans-[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8004847 |
| Molecular Formula | C14H13F3N2O5 |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | trans-[2-[4-nitro-2-(trifluoromethyl)anilino]-2-oxoethyl] (1S,2S)-2-methylcyclopropane-1-carboxylate |
| SMILES | C[C@H]1C[C@@H]1C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O5/c1-7-4-9(7)13(21)24-6-12(20)18-11-3-2-8(19(22)23)5-10(11)14(15,16)17/h2-3,5,7,9H,4,6H2,1H3,(H,18,20)/t7-,9-/m0/s1 |
| InChIKey | HOLGERKCZTWGMP-CBAPKCEASA-N |
| XLogP | 2.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|