C14H14F3NO3 — CID 3515684
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-methylcyclopropane-1-carboxylate (PubChem CID 3515684) has the molecular formula C14H14F3NO3 and a molecular weight of 301.26 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-methylcyclopropane-1-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 3515684 |
| Molecular Formula | C14H14F3NO3 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 2-methylcyclopropane-1-carboxylate |
| SMILES | CC1CC1C(=O)OCC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3/c1-8-6-9(8)13(20)21-7-12(19)18-11-5-3-2-4-10(11)14(15,16)17/h2-5,8-9H,6-7H2,1H3,(H,18,19) |
| InChIKey | KLHGNEZEZUMROU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |