C14H12F3N5O3S — CID 30007954
2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide (PubChem CID 30007954) has the molecular formula C14H12F3N5O3S and a molecular weight of 387.34 g/mol. Its IUPAC name is 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 30007954 |
| Molecular Formula | C14H12F3N5O3S |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-(4-amino-6-methylpyrimidin-2-yl)sulfanyl-N-[4-nitro-2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1cc(N)nc(SCC(=O)Nc2ccc([N+](=O)[O-])cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C14H12F3N5O3S/c1-7-4-11(18)21-13(19-7)26-6-12(23)20-10-3-2-8(22(24)25)5-9(10)14(15,16)17/h2-5H,6H2,1H3,(H,20,23)(H2,18,19,21) |
| InChIKey | SKXYQCROEBRIFF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|