C20H18F3N5OS — CID 112843206
N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 112843206) has the molecular formula C20H18F3N5OS and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 112843206 |
| Molecular Formula | C20H18F3N5OS |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]-2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1nc2nc(SCC(=O)NCC#Cc3cccc(C(F)(F)F)c3)nn2c(C)c1C |
| InChI | InChI=1S/C20H18F3N5OS/c1-12-13(2)25-18-26-19(27-28(18)14(12)3)30-11-17(29)24-9-5-7-15-6-4-8-16(10-15)20(21,22)23/h4,6,8,10H,9,11H2,1-3H3,(H,24,29) |
| InChIKey | HQUKLACAXDIUKZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|