C22H26N6O2S — CID 55737763
N-cyclopentyl-2-[[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide (PubChem CID 55737763) has the molecular formula C22H26N6O2S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55737763 |
| Molecular Formula | C22H26N6O2S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | N-cyclopentyl-2-[[2-[(5,6,7-trimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]acetyl]amino]benzamide |
| SMILES | Cc1nc2nc(SCC(=O)Nc3ccccc3C(=O)NC3CCCC3)nn2c(C)c1C |
| InChI | InChI=1S/C22H26N6O2S/c1-13-14(2)23-21-26-22(27-28(21)15(13)3)31-12-19(29)25-18-11-7-6-10-17(18)20(30)24-16-8-4-5-9-16/h6-7,10-11,16H,4-5,8-9,12H2,1-3H3,(H,24,30)(H,25,29) |
| InChIKey | DLPDSKRDIXDVMP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |