C16H19N5O2S — CID 7784903
N-cyclopentyl-2-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzamide (PubChem CID 7784903) has the molecular formula C16H19N5O2S and a molecular weight of 345.43 g/mol. Its IUPAC name is N-cyclopentyl-2-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 7784903 |
| Molecular Formula | C16H19N5O2S |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N-cyclopentyl-2-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzamide |
| SMILES | O=C(CSc1ncn[nH]1)Nc1ccccc1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H19N5O2S/c22-14(9-24-16-17-10-18-21-16)20-13-8-4-3-7-12(13)15(23)19-11-5-1-2-6-11/h3-4,7-8,10-11H,1-2,5-6,9H2,(H,19,23)(H,20,22)(H,17,18,21) |
| InChIKey | AJLSBAGRELLRMQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |