C24H16N6O4S2 — CID 6413506
3-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]ethylsulfanyl]-5,6-bis(furan-2-yl)-1,2,4-triazine (PubChem CID 6413506) has the molecular formula C24H16N6O4S2 and a molecular weight of 516.56 g/mol. Its IUPAC name is 3-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]ethylsulfanyl]-5,6-bis(furan-2-yl)-1,2,4-triazine.
| Compound Name | 3-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]ethylsulfanyl]-5,6-bis(furan-2-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 6413506 |
| Molecular Formula | C24H16N6O4S2 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 3-[2-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]ethylsulfanyl]-5,6-bis(furan-2-yl)-1,2,4-triazine |
| SMILES | c1coc(-c2nnc(SCCSc3nnc(-c4ccco4)c(-c4ccco4)n3)nc2-c2ccco2)c1 |
| InChI | InChI=1S/C24H16N6O4S2/c1-5-15(31-9-1)19-21(17-7-3-11-33-17)27-29-23(25-19)35-13-14-36-24-26-20(16-6-2-10-32-16)22(28-30-24)18-8-4-12-34-18/h1-12H,13-14H2 |
| InChIKey | IDMYSMXRSYWVNK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 129.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|