C20H17N5O3S — CID 23917159
3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4-methyl-2-pyridinyl)propanamide (PubChem CID 23917159) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4-methyl-2-pyridinyl)propanamide.
| Compound Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4-methyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 23917159 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-(4-methyl-2-pyridinyl)propanamide |
| SMILES | Cc1ccnc(NC(=O)CCSc2nnc(-c3ccco3)c(-c3ccco3)n2)c1 |
| InChI | InChI=1S/C20H17N5O3S/c1-13-6-8-21-16(12-13)22-17(26)7-11-29-20-23-18(14-4-2-9-27-14)19(24-25-20)15-5-3-10-28-15/h2-6,8-10,12H,7,11H2,1H3,(H,21,22,26) |
| InChIKey | MUNUJWJUECELRV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|