C25H20N6O5S2 — CID 25039877
3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 25039877) has the molecular formula C25H20N6O5S2 and a molecular weight of 548.61 g/mol. Its IUPAC name is 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 25039877 |
| Molecular Formula | C25H20N6O5S2 |
| Molecular Weight | 548.61 g/mol |
| Exact Mass | 548.09 |
| IUPAC Name | 3-[[5,6-bis(furan-2-yl)-1,2,4-triazin-3-yl]sulfanyl]-N-[4-(pyridin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCSc1nnc(-c2ccco2)c(-c2ccco2)n1)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C25H20N6O5S2/c32-22(27-17-8-10-18(11-9-17)38(33,34)31-21-7-1-2-13-26-21)12-16-37-25-28-23(19-5-3-14-35-19)24(29-30-25)20-6-4-15-36-20/h1-11,13-15H,12,16H2,(H,26,31)(H,27,32) |
| InChIKey | YMUYABKSXJDHFM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het_thio_6_furan(4)', 'substructure': 'N/A'} |
|---|