C19H19N5O3S2 — CID 25036549
N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-3-pyridin-2-ylsulfanylpropanamide (PubChem CID 25036549) has the molecular formula C19H19N5O3S2 and a molecular weight of 429.53 g/mol. Its IUPAC name is N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-3-pyridin-2-ylsulfanylpropanamide.
| Compound Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-3-pyridin-2-ylsulfanylpropanamide |
|---|---|
| PubChem CID | 25036549 |
| Molecular Formula | C19H19N5O3S2 |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-3-pyridin-2-ylsulfanylpropanamide |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)CCSc3ccccn3)cc2)n1 |
| InChI | InChI=1S/C19H19N5O3S2/c1-14-9-12-21-19(22-14)24-29(26,27)16-7-5-15(6-8-16)23-17(25)10-13-28-18-4-2-3-11-20-18/h2-9,11-12H,10,13H2,1H3,(H,23,25)(H,21,22,24) |
| InChIKey | XUPLEJXSTZEGGW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |