C18H17N5O3S2 — CID 25043950
3-pyridin-2-ylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 25043950) has the molecular formula C18H17N5O3S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 3-pyridin-2-ylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 3-pyridin-2-ylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 25043950 |
| Molecular Formula | C18H17N5O3S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 3-pyridin-2-ylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | O=C(CCSc1ccccn1)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C18H17N5O3S2/c24-16(9-13-27-17-4-1-2-10-19-17)22-14-5-7-15(8-6-14)28(25,26)23-18-20-11-3-12-21-18/h1-8,10-12H,9,13H2,(H,22,24)(H,20,21,23) |
| InChIKey | PBBDYGBPXLSZMG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |