C13H14N4O3S2 — CID 25038576
3-pyrimidin-2-ylsulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 25038576) has the molecular formula C13H14N4O3S2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-pyrimidin-2-ylsulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-pyrimidin-2-ylsulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 25038576 |
| Molecular Formula | C13H14N4O3S2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 3-pyrimidin-2-ylsulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCSc2ncccn2)cc1 |
| InChI | InChI=1S/C13H14N4O3S2/c14-22(19,20)11-4-2-10(3-5-11)17-12(18)6-9-21-13-15-7-1-8-16-13/h1-5,7-8H,6,9H2,(H,17,18)(H2,14,19,20) |
| InChIKey | XXIAIKAVGFRAFQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |