C16H16Cl2N2O3S2 — CID 34502642
3-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-sulfamoylphenyl)propanamide (PubChem CID 34502642) has the molecular formula C16H16Cl2N2O3S2 and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | 3-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 34502642 |
| Molecular Formula | C16H16Cl2N2O3S2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methylsulfanyl]-N-(4-sulfamoylphenyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CCSCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O3S2/c17-14-2-1-3-15(18)13(14)10-24-9-8-16(21)20-11-4-6-12(7-5-11)25(19,22)23/h1-7H,8-10H2,(H,20,21)(H2,19,22,23) |
| InChIKey | ZEQMEWGPPZTWSK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|