C17H14Cl4OS2 — CID 12816884
S-[(2,6-dichlorophenyl)methyl] 3-[(2,6-dichlorophenyl)methylsulfanyl]propanethioate (PubChem CID 12816884) has the molecular formula C17H14Cl4OS2 and a molecular weight of 440.24 g/mol. Its IUPAC name is S-[(2,6-dichlorophenyl)methyl] 3-[(2,6-dichlorophenyl)methylsulfanyl]propanethioate.
| Compound Name | S-[(2,6-dichlorophenyl)methyl] 3-[(2,6-dichlorophenyl)methylsulfanyl]propanethioate |
|---|---|
| PubChem CID | 12816884 |
| Molecular Formula | C17H14Cl4OS2 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 437.92 |
| IUPAC Name | S-[(2,6-dichlorophenyl)methyl] 3-[(2,6-dichlorophenyl)methylsulfanyl]propanethioate |
| SMILES | O=C(CCSCc1c(Cl)cccc1Cl)SCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H14Cl4OS2/c18-13-3-1-4-14(19)11(13)9-23-8-7-17(22)24-10-12-15(20)5-2-6-16(12)21/h1-6H,7-10H2 |
| InChIKey | PTYXKMYXCAUBPN-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|