C18H18Cl2FNOS2 — CID 126031261
N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 126031261) has the molecular formula C18H18Cl2FNOS2 and a molecular weight of 418.39 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 126031261 |
| Molecular Formula | C18H18Cl2FNOS2 |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)NCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C18H18Cl2FNOS2/c19-13-4-6-14(7-5-13)25-10-8-18(23)22-9-11-24-12-15-16(20)2-1-3-17(15)21/h1-7H,8-12H2,(H,22,23) |
| InChIKey | NGFYZQMOJFUZRQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|