C16H14ClFN2O3S — CID 2177989
N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-nitrobenzamide (PubChem CID 2177989) has the molecular formula C16H14ClFN2O3S and a molecular weight of 368.82 g/mol. Its IUPAC name is N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 2177989 |
| Molecular Formula | C16H14ClFN2O3S |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-4-nitrobenzamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14ClFN2O3S/c17-14-2-1-3-15(18)13(14)10-24-9-8-19-16(21)11-4-6-12(7-5-11)20(22)23/h1-7H,8-10H2,(H,19,21) |
| InChIKey | BSDLSJHHWVIRKT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|