C23H21ClFN3O5S2 — CID 17312899
2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide (PubChem CID 17312899) has the molecular formula C23H21ClFN3O5S2 and a molecular weight of 538.02 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 17312899 |
| Molecular Formula | C23H21ClFN3O5S2 |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-nitroanilino]-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]acetamide |
| SMILES | O=C(CN(c1ccc([N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1)NCCSCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H21ClFN3O5S2/c24-21-7-4-8-22(25)20(21)16-34-14-13-26-23(29)15-27(17-9-11-18(12-10-17)28(30)31)35(32,33)19-5-2-1-3-6-19/h1-12H,13-16H2,(H,26,29) |
| InChIKey | XPDMGNAPVWGEPK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|