C22H19Cl2FN2O3S2 — CID 46763529
4-(benzenesulfonamido)-3-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]benzamide (PubChem CID 46763529) has the molecular formula C22H19Cl2FN2O3S2 and a molecular weight of 513.44 g/mol. Its IUPAC name is 4-(benzenesulfonamido)-3-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]benzamide.
| Compound Name | 4-(benzenesulfonamido)-3-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]benzamide |
|---|---|
| PubChem CID | 46763529 |
| Molecular Formula | C22H19Cl2FN2O3S2 |
| Molecular Weight | 513.44 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | 4-(benzenesulfonamido)-3-chloro-N-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]benzamide |
| SMILES | O=C(NCCSCc1c(F)cccc1Cl)c1ccc(NS(=O)(=O)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C22H19Cl2FN2O3S2/c23-18-7-4-8-20(25)17(18)14-31-12-11-26-22(28)15-9-10-21(19(24)13-15)27-32(29,30)16-5-2-1-3-6-16/h1-10,13,27H,11-12,14H2,(H,26,28) |
| InChIKey | KQRMPYWGVBJHHR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|