C23H22Cl2N2O3S2 — CID 43908652
3-chloro-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 43908652) has the molecular formula C23H22Cl2N2O3S2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 3-chloro-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 3-chloro-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 43908652 |
| Molecular Formula | C23H22Cl2N2O3S2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.04 |
| IUPAC Name | 3-chloro-N-[2-[(4-chlorophenyl)methylsulfanyl]ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCCSCc3ccc(Cl)cc3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O3S2/c1-16-2-9-20(10-3-16)32(29,30)27-22-11-6-18(14-21(22)25)23(28)26-12-13-31-15-17-4-7-19(24)8-5-17/h2-11,14,27H,12-13,15H2,1H3,(H,26,28) |
| InChIKey | RUBFPBARSCNEGW-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|