C21H21ClN2O4S2 — CID 92681539
3-chloro-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide (PubChem CID 92681539) has the molecular formula C21H21ClN2O4S2 and a molecular weight of 465.00 g/mol. Its IUPAC name is 3-chloro-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide.
| Compound Name | 3-chloro-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 92681539 |
| Molecular Formula | C21H21ClN2O4S2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 3-chloro-N-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-[(4-methylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(C(=O)NCCSCc3ccco3)cc2Cl)cc1 |
| InChI | InChI=1S/C21H21ClN2O4S2/c1-15-4-7-18(8-5-15)30(26,27)24-20-9-6-16(13-19(20)22)21(25)23-10-12-29-14-17-3-2-11-28-17/h2-9,11,13,24H,10,12,14H2,1H3,(H,23,25) |
| InChIKey | CRJCYKHSTUHXRM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|