C21H22N2O5S2 — CID 17484047
N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 17484047) has the molecular formula C21H22N2O5S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 17484047 |
| Molecular Formula | C21H22N2O5S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | N-[2-(furan-2-ylmethylsulfanyl)ethyl]-3-[(2-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NCCSCc2ccco2)c1 |
| InChI | InChI=1S/C21H22N2O5S2/c1-27-20-10-3-2-9-19(20)23-30(25,26)18-8-4-6-16(14-18)21(24)22-11-13-29-15-17-7-5-12-28-17/h2-10,12,14,23H,11,13,15H2,1H3,(H,22,24) |
| InChIKey | JHJFUHRMZFZIDB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|