C23H24N2O4S2 — CID 55394039
3-[(2-methoxyphenyl)sulfamoyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide (PubChem CID 55394039) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
|---|---|
| PubChem CID | 55394039 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[2-(4-methylphenyl)sulfanylethyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NCCSc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-17-10-12-19(13-11-17)30-15-14-24-23(26)18-6-5-7-20(16-18)31(27,28)25-21-8-3-4-9-22(21)29-2/h3-13,16,25H,14-15H2,1-2H3,(H,24,26) |
| InChIKey | SEOJZOTVTBAGDP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|