C20H24F3N3O4S — CID 55720773
3-[(2-methoxyphenyl)sulfamoyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzamide (PubChem CID 55720773) has the molecular formula C20H24F3N3O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzamide |
|---|---|
| PubChem CID | 55720773 |
| Molecular Formula | C20H24F3N3O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NCCCN(C)CC(F)(F)F)c1 |
| InChI | InChI=1S/C20H24F3N3O4S/c1-26(14-20(21,22)23)12-6-11-24-19(27)15-7-5-8-16(13-15)31(28,29)25-17-9-3-4-10-18(17)30-2/h3-5,7-10,13,25H,6,11-12,14H2,1-2H3,(H,24,27) |
| InChIKey | ZWHDYQYYMGYTRD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|