C24H26ClN3O3S — CID 31588662
N-[3-[benzyl(methyl)amino]propyl]-3-[(2-chlorophenyl)sulfamoyl]benzamide (PubChem CID 31588662) has the molecular formula C24H26ClN3O3S and a molecular weight of 472.01 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-3-[(2-chlorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-3-[(2-chlorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 31588662 |
| Molecular Formula | C24H26ClN3O3S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-3-[(2-chlorophenyl)sulfamoyl]benzamide |
| SMILES | CN(CCCNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C24H26ClN3O3S/c1-28(18-19-9-3-2-4-10-19)16-8-15-26-24(29)20-11-7-12-21(17-20)32(30,31)27-23-14-6-5-13-22(23)25/h2-7,9-14,17,27H,8,15-16,18H2,1H3,(H,26,29) |
| InChIKey | DWCKZPPFRFNSEI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|