C18H22FN3O3S — CID 109064246
N-[3-(dimethylamino)propyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide (PubChem CID 109064246) has the molecular formula C18H22FN3O3S and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 109064246 |
| Molecular Formula | C18H22FN3O3S |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[(2-fluorophenyl)sulfamoyl]benzamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(S(=O)(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C18H22FN3O3S/c1-22(2)12-6-11-20-18(23)14-7-5-8-15(13-14)26(24,25)21-17-10-4-3-9-16(17)19/h3-5,7-10,13,21H,6,11-12H2,1-2H3,(H,20,23) |
| InChIKey | TXPCUJOZQZBRQQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|