C23H24FN3O3S — CID 43017074
4-[(2-fluorophenyl)sulfamoyl]-N-[3-(N-methylanilino)propyl]benzamide (PubChem CID 43017074) has the molecular formula C23H24FN3O3S and a molecular weight of 441.53 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(N-methylanilino)propyl]benzamide.
| Compound Name | 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(N-methylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 43017074 |
| Molecular Formula | C23H24FN3O3S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(N-methylanilino)propyl]benzamide |
| SMILES | CN(CCCNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H24FN3O3S/c1-27(19-8-3-2-4-9-19)17-7-16-25-23(28)18-12-14-20(15-13-18)31(29,30)26-22-11-6-5-10-21(22)24/h2-6,8-15,26H,7,16-17H2,1H3,(H,25,28) |
| InChIKey | CFQZMHDWCJXHJA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|