C23H21F2N3O4S — CID 24666950
3-fluoro-N-[2-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]ethyl]-4-methylbenzamide (PubChem CID 24666950) has the molecular formula C23H21F2N3O4S and a molecular weight of 473.50 g/mol. Its IUPAC name is 3-fluoro-N-[2-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]ethyl]-4-methylbenzamide.
| Compound Name | 3-fluoro-N-[2-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 24666950 |
| Molecular Formula | C23H21F2N3O4S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | 3-fluoro-N-[2-[[4-[(2-fluorophenyl)sulfamoyl]benzoyl]amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)c2ccc(S(=O)(=O)Nc3ccccc3F)cc2)cc1F |
| InChI | InChI=1S/C23H21F2N3O4S/c1-15-6-7-17(14-20(15)25)23(30)27-13-12-26-22(29)16-8-10-18(11-9-16)33(31,32)28-21-5-3-2-4-19(21)24/h2-11,14,28H,12-13H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | SJTIKXPZTPAHCO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|