C14H14FNO2S — CID 17377370
N-(2-fluorophenyl)-3,4-dimethylbenzenesulfonamide (PubChem CID 17377370) has the molecular formula C14H14FNO2S and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(2-fluorophenyl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 17377370 |
| Molecular Formula | C14H14FNO2S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(2-fluorophenyl)-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccccc2F)cc1C |
| InChI | InChI=1S/C14H14FNO2S/c1-10-7-8-12(9-11(10)2)19(17,18)16-14-6-4-3-5-13(14)15/h3-9,16H,1-2H3 |
| InChIKey | NDEJDBBJPYXFFG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |