C22H21FN2O3S — CID 27647283
4-[(2-fluorophenyl)sulfamoyl]-N-(3-phenylpropyl)benzamide (PubChem CID 27647283) has the molecular formula C22H21FN2O3S and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfamoyl]-N-(3-phenylpropyl)benzamide.
| Compound Name | 4-[(2-fluorophenyl)sulfamoyl]-N-(3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 27647283 |
| Molecular Formula | C22H21FN2O3S |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfamoyl]-N-(3-phenylpropyl)benzamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C22H21FN2O3S/c23-20-10-4-5-11-21(20)25-29(27,28)19-14-12-18(13-15-19)22(26)24-16-6-9-17-7-2-1-3-8-17/h1-5,7-8,10-15,25H,6,9,16H2,(H,24,26) |
| InChIKey | WPKGMZSSEHWQRQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|