C24H23FN2O2 — CID 109047171
4-N-[(2-fluorophenyl)methyl]-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide (PubChem CID 109047171) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109047171 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]-1-N-(3-phenylpropyl)benzene-1,4-dicarboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1ccc(C(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C24H23FN2O2/c25-22-11-5-4-10-21(22)17-27-24(29)20-14-12-19(13-15-20)23(28)26-16-6-9-18-7-2-1-3-8-18/h1-5,7-8,10-15H,6,9,16-17H2,(H,26,28)(H,27,29) |
| InChIKey | KIBUKMOFUUDTQV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|