C19H21FN2O3 — CID 109045263
4-N-[(2-fluorophenyl)methyl]-1-N-(3-methoxypropyl)benzene-1,4-dicarboxamide (PubChem CID 109045263) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-N-[(2-fluorophenyl)methyl]-1-N-(3-methoxypropyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(2-fluorophenyl)methyl]-1-N-(3-methoxypropyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109045263 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 4-N-[(2-fluorophenyl)methyl]-1-N-(3-methoxypropyl)benzene-1,4-dicarboxamide |
| SMILES | COCCCNC(=O)c1ccc(C(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H21FN2O3/c1-25-12-4-11-21-18(23)14-7-9-15(10-8-14)19(24)22-13-16-5-2-3-6-17(16)20/h2-3,5-10H,4,11-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | XKGXYFPYHBAKRB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|