C19H23FN2O5S — CID 55407931
4-[(2-fluorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)propyl]benzamide (PubChem CID 55407931) has the molecular formula C19H23FN2O5S and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)propyl]benzamide.
| Compound Name | 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)propyl]benzamide |
|---|---|
| PubChem CID | 55407931 |
| Molecular Formula | C19H23FN2O5S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 4-[(2-fluorophenyl)sulfamoyl]-N-[3-(2-methoxyethoxy)propyl]benzamide |
| SMILES | COCCOCCCNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2F)cc1 |
| InChI | InChI=1S/C19H23FN2O5S/c1-26-13-14-27-12-4-11-21-19(23)15-7-9-16(10-8-15)28(24,25)22-18-6-3-2-5-17(18)20/h2-3,5-10,22H,4,11-14H2,1H3,(H,21,23) |
| InChIKey | IVDNMHOTHWJPMU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|