C17H16F2N2O6S — CID 130296884
2,5-difluoro-4-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylamino]benzoic acid (PubChem CID 130296884) has the molecular formula C17H16F2N2O6S and a molecular weight of 414.39 g/mol. Its IUPAC name is 2,5-difluoro-4-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2,5-difluoro-4-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 130296884 |
| Molecular Formula | C17H16F2N2O6S |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 2,5-difluoro-4-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylamino]benzoic acid |
| SMILES | COCCNC(=O)c1ccc(S(=O)(=O)Nc2cc(F)c(C(=O)O)cc2F)cc1 |
| InChI | InChI=1S/C17H16F2N2O6S/c1-27-7-6-20-16(22)10-2-4-11(5-3-10)28(25,26)21-15-9-13(18)12(17(23)24)8-14(15)19/h2-5,8-9,21H,6-7H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | ROANCNVXDRQRHU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|