C14H12BF2NO7S — CID 142768643
[4-[(2,5-difluoro-4-methoxycarbonylphenyl)sulfamoyl]phenoxy]boronic acid (PubChem CID 142768643) has the molecular formula C14H12BF2NO7S and a molecular weight of 387.13 g/mol. Its IUPAC name is [4-[(2,5-difluoro-4-methoxycarbonylphenyl)sulfamoyl]phenoxy]boronic acid.
| Compound Name | [4-[(2,5-difluoro-4-methoxycarbonylphenyl)sulfamoyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 142768643 |
| Molecular Formula | C14H12BF2NO7S |
| Molecular Weight | 387.13 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | [4-[(2,5-difluoro-4-methoxycarbonylphenyl)sulfamoyl]phenoxy]boronic acid |
| SMILES | COC(=O)c1cc(F)c(NS(=O)(=O)c2ccc(OB(O)O)cc2)cc1F |
| InChI | InChI=1S/C14H12BF2NO7S/c1-24-14(19)10-6-12(17)13(7-11(10)16)18-26(22,23)9-4-2-8(3-5-9)25-15(20)21/h2-7,18,20-21H,1H3 |
| InChIKey | AKKVBVQNKFRDDF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.13 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|