C15H12BrF2NO5S — CID 31808235
methyl 5-[(5-bromo-2-methoxyphenyl)sulfonylamino]-2,4-difluorobenzoate (PubChem CID 31808235) has the molecular formula C15H12BrF2NO5S and a molecular weight of 436.23 g/mol. Its IUPAC name is methyl 5-[(5-bromo-2-methoxyphenyl)sulfonylamino]-2,4-difluorobenzoate.
| Compound Name | methyl 5-[(5-bromo-2-methoxyphenyl)sulfonylamino]-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 31808235 |
| Molecular Formula | C15H12BrF2NO5S |
| Molecular Weight | 436.23 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | methyl 5-[(5-bromo-2-methoxyphenyl)sulfonylamino]-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)c2cc(Br)ccc2OC)c(F)cc1F |
| InChI | InChI=1S/C15H12BrF2NO5S/c1-23-13-4-3-8(16)5-14(13)25(21,22)19-12-6-9(15(20)24-2)10(17)7-11(12)18/h3-7,19H,1-2H3 |
| InChIKey | GCXZDBMLMGEWPF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |