C8H8F2N2O4S — CID 112573353
methyl 2,4-difluoro-5-(sulfamoylamino)benzoate (PubChem CID 112573353) has the molecular formula C8H8F2N2O4S and a molecular weight of 266.23 g/mol. Its IUPAC name is methyl 2,4-difluoro-5-(sulfamoylamino)benzoate.
| Compound Name | methyl 2,4-difluoro-5-(sulfamoylamino)benzoate |
|---|---|
| PubChem CID | 112573353 |
| Molecular Formula | C8H8F2N2O4S |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | methyl 2,4-difluoro-5-(sulfamoylamino)benzoate |
| SMILES | COC(=O)c1cc(NS(N)(=O)=O)c(F)cc1F |
| InChI | InChI=1S/C8H8F2N2O4S/c1-16-8(13)4-2-7(12-17(11,14)15)6(10)3-5(4)9/h2-3,12H,1H3,(H2,11,14,15) |
| InChIKey | SEKIFNGULNNXDR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |