C11H12ClF2NO4S — CID 43654285
methyl 5-(3-chloropropylsulfonylamino)-2,4-difluorobenzoate (PubChem CID 43654285) has the molecular formula C11H12ClF2NO4S and a molecular weight of 327.74 g/mol. Its IUPAC name is methyl 5-(3-chloropropylsulfonylamino)-2,4-difluorobenzoate.
| Compound Name | methyl 5-(3-chloropropylsulfonylamino)-2,4-difluorobenzoate |
|---|---|
| PubChem CID | 43654285 |
| Molecular Formula | C11H12ClF2NO4S |
| Molecular Weight | 327.74 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | methyl 5-(3-chloropropylsulfonylamino)-2,4-difluorobenzoate |
| SMILES | COC(=O)c1cc(NS(=O)(=O)CCCCl)c(F)cc1F |
| InChI | InChI=1S/C11H12ClF2NO4S/c1-19-11(16)7-5-10(9(14)6-8(7)13)15-20(17,18)4-2-3-12/h5-6,15H,2-4H2,1H3 |
| InChIKey | MNMBJELWPZCEKV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.74 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|