C30H49ClN2O5S — CID 139893150
methyl 2-(3-chloropropylsulfonylamino)-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate (PubChem CID 139893150) has the molecular formula C30H49ClN2O5S and a molecular weight of 585.25 g/mol. Its IUPAC name is methyl 2-(3-chloropropylsulfonylamino)-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate.
| Compound Name | methyl 2-(3-chloropropylsulfonylamino)-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 139893150 |
| Molecular Formula | C30H49ClN2O5S |
| Molecular Weight | 585.25 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | methyl 2-(3-chloropropylsulfonylamino)-4-[[(Z)-octadec-9-enyl]carbamoyl]benzoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)c1ccc(C(=O)OC)c(NS(=O)(=O)CCCCl)c1 |
| InChI | InChI=1S/C30H49ClN2O5S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-32-29(34)26-20-21-27(30(35)38-2)28(25-26)33-39(36,37)24-19-22-31/h10-11,20-21,25,33H,3-9,12-19,22-24H2,1-2H3,(H,32,34)/b11-10- |
| InChIKey | MNQPQESXGCPYLD-KHPPLWFESA-N |
| XLogP | 7.61 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.25 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|