C17H27ClN2O3S — CID 60604741
4-chloro-3-(methanesulfonamido)-N-nonylbenzamide (PubChem CID 60604741) has the molecular formula C17H27ClN2O3S and a molecular weight of 374.93 g/mol. Its IUPAC name is 4-chloro-3-(methanesulfonamido)-N-nonylbenzamide.
| Compound Name | 4-chloro-3-(methanesulfonamido)-N-nonylbenzamide |
|---|---|
| PubChem CID | 60604741 |
| Molecular Formula | C17H27ClN2O3S |
| Molecular Weight | 374.93 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4-chloro-3-(methanesulfonamido)-N-nonylbenzamide |
| SMILES | CCCCCCCCCNC(=O)c1ccc(Cl)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C17H27ClN2O3S/c1-3-4-5-6-7-8-9-12-19-17(21)14-10-11-15(18)16(13-14)20-24(2,22)23/h10-11,13,20H,3-9,12H2,1-2H3,(H,19,21) |
| InChIKey | WZZJTYVKDNMKGG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|