C14H21ClN2O3S — CID 49021281
4-chloro-N-(3,3-dimethylbutyl)-3-(methanesulfonamido)benzamide (PubChem CID 49021281) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is 4-chloro-N-(3,3-dimethylbutyl)-3-(methanesulfonamido)benzamide.
| Compound Name | 4-chloro-N-(3,3-dimethylbutyl)-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 49021281 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 4-chloro-N-(3,3-dimethylbutyl)-3-(methanesulfonamido)benzamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccc(Cl)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-14(2,3)7-8-16-13(18)10-5-6-11(15)12(9-10)17-21(4,19)20/h5-6,9,17H,7-8H2,1-4H3,(H,16,18) |
| InChIKey | XVRIIYWMAQJWOG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |