C10H9ClN2O3S — CID 23592519
N-[2-chloro-5-(2-cyanoacetyl)phenyl]methanesulfonamide (PubChem CID 23592519) has the molecular formula C10H9ClN2O3S and a molecular weight of 272.71 g/mol. Its IUPAC name is N-[2-chloro-5-(2-cyanoacetyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-chloro-5-(2-cyanoacetyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 23592519 |
| Molecular Formula | C10H9ClN2O3S |
| Molecular Weight | 272.71 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | N-[2-chloro-5-(2-cyanoacetyl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)CC#N)ccc1Cl |
| InChI | InChI=1S/C10H9ClN2O3S/c1-17(15,16)13-9-6-7(2-3-8(9)11)10(14)4-5-12/h2-3,6,13H,4H2,1H3 |
| InChIKey | DIPNQEQITZITQO-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.71 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |