C10H10ClF3N2O3S — CID 49019461
4-chloro-3-(methanesulfonamido)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 49019461) has the molecular formula C10H10ClF3N2O3S and a molecular weight of 330.72 g/mol. Its IUPAC name is 4-chloro-3-(methanesulfonamido)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-chloro-3-(methanesulfonamido)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 49019461 |
| Molecular Formula | C10H10ClF3N2O3S |
| Molecular Weight | 330.72 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 4-chloro-3-(methanesulfonamido)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)NCC(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H10ClF3N2O3S/c1-20(18,19)16-8-4-6(2-3-7(8)11)9(17)15-5-10(12,13)14/h2-4,16H,5H2,1H3,(H,15,17) |
| InChIKey | YJFPSFZHPXIVOG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |